C25H28O6 — CID 162815240
2-[3-[[(2S)-3,3-dimethyloxiran-2-yl]methoxy]-2-hydroxy-5-methylbenzoyl]-6-hydroxy-3-(3-methylbut-2-enyl)benzaldehyde (PubChem CID 162815240) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-[3-[[(2S)-3,3-dimethyloxiran-2-yl]methoxy]-2-hydroxy-5-methylbenzoyl]-6-hydroxy-3-(3-methylbut-2-enyl)benzaldehyde.
| Compound Name | 2-[3-[[(2S)-3,3-dimethyloxiran-2-yl]methoxy]-2-hydroxy-5-methylbenzoyl]-6-hydroxy-3-(3-methylbut-2-enyl)benzaldehyde |
|---|---|
| PubChem CID | 162815240 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-[3-[[(2S)-3,3-dimethyloxiran-2-yl]methoxy]-2-hydroxy-5-methylbenzoyl]-6-hydroxy-3-(3-methylbut-2-enyl)benzaldehyde |
| SMILES | CC(C)=CCc1ccc(O)c(C=O)c1C(=O)c1cc(C)cc(OC[C@@H]2OC2(C)C)c1O |
| InChI | InChI=1S/C25H28O6/c1-14(2)6-7-16-8-9-19(27)18(12-26)22(16)24(29)17-10-15(3)11-20(23(17)28)30-13-21-25(4,5)31-21/h6,8-12,21,27-28H,7,13H2,1-5H3/t21-/m0/s1 |
| InChIKey | YYVUTTJWDVICKP-NRFANRHFSA-N |
| XLogP | 4.51 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|