C21H22O5 — CID 132850854
(6R)-1,10-dihydroxy-6-methoxy-8-methyl-2-(3-methylbut-2-enyl)-6H-benzo[c][1]benzoxepin-11-one (PubChem CID 132850854) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is (6R)-1,10-dihydroxy-6-methoxy-8-methyl-2-(3-methylbut-2-enyl)-6H-benzo[c][1]benzoxepin-11-one.
| Compound Name | (6R)-1,10-dihydroxy-6-methoxy-8-methyl-2-(3-methylbut-2-enyl)-6H-benzo[c][1]benzoxepin-11-one |
|---|---|
| PubChem CID | 132850854 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (6R)-1,10-dihydroxy-6-methoxy-8-methyl-2-(3-methylbut-2-enyl)-6H-benzo[c][1]benzoxepin-11-one |
| SMILES | CO[C@@H]1Oc2ccc(CC=C(C)C)c(O)c2C(=O)c2c(O)cc(C)cc21 |
| InChI | InChI=1S/C21H22O5/c1-11(2)5-6-13-7-8-16-18(19(13)23)20(24)17-14(21(25-4)26-16)9-12(3)10-15(17)22/h5,7-10,21-23H,6H2,1-4H3/t21-/m1/s1 |
| InChIKey | UBSZCWHAQQNZNG-OAQYLSRUSA-N |
| XLogP | 4.18 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|