C50H54O8 — CID 163008567
10-[2-(3,7-dimethylocta-2,6-dienoxy)-4,5-dihydroxy-7-methyl-10-oxo-9H-anthracen-9-yl]-2-(3,7-dimethylocta-2,6-dienyl)-1,3,8-trihydroxy-6-methyl-10H-anthracen-9-one (PubChem CID 163008567) has the molecular formula C50H54O8 and a molecular weight of 782.97 g/mol. Its IUPAC name is 10-[2-(3,7-dimethylocta-2,6-dienoxy)-4,5-dihydroxy-7-methyl-10-oxo-9H-anthracen-9-yl]-2-(3,7-dimethylocta-2,6-dienyl)-1,3,8-trihydroxy-6-methyl-10H-anthracen-9-one.
| Compound Name | 10-[2-(3,7-dimethylocta-2,6-dienoxy)-4,5-dihydroxy-7-methyl-10-oxo-9H-anthracen-9-yl]-2-(3,7-dimethylocta-2,6-dienyl)-1,3,8-trihydroxy-6-methyl-10H-anthracen-9-one |
|---|---|
| PubChem CID | 163008567 |
| Molecular Formula | C50H54O8 |
| Molecular Weight | 782.97 g/mol |
| Exact Mass | 782.38 |
| IUPAC Name | 10-[2-(3,7-dimethylocta-2,6-dienoxy)-4,5-dihydroxy-7-methyl-10-oxo-9H-anthracen-9-yl]-2-(3,7-dimethylocta-2,6-dienyl)-1,3,8-trihydroxy-6-methyl-10H-anthracen-9-one |
| SMILES | CC(C)=CCCC(C)=CCOc1cc(O)c2c(c1)C(C1c3cc(C)cc(O)c3C(=O)c3c1cc(O)c(CC=C(C)CCC=C(C)C)c3O)c1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C50H54O8/c1-26(2)11-9-13-28(5)15-16-33-38(51)25-37-43(35-20-31(8)22-40(53)45(35)50(57)47(37)48(33)55)42-34-19-30(7)21-39(52)44(34)49(56)46-36(42)23-32(24-41(46)54)58-18-17-29(6)14-10-12-27(3)4/h11-12,15,17,19-25,42-43,51-55H,9-10,13-14,16,18H2,1-8H3 |
| InChIKey | OYOMKXPSOXDUMB-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.97 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|