C45H46O8 — CID 74323877
10-[4,5-dihydroxy-2-methyl-7-(3-methylbut-2-enoxy)-10-oxo-9H-anthracen-9-yl]-2-(3,7-dimethylocta-2,6-dienyl)-1,3,8-trihydroxy-6-methyl-10H-anthracen-9-one (PubChem CID 74323877) has the molecular formula C45H46O8 and a molecular weight of 714.85 g/mol. Its IUPAC name is 10-[4,5-dihydroxy-2-methyl-7-(3-methylbut-2-enoxy)-10-oxo-9H-anthracen-9-yl]-2-(3,7-dimethylocta-2,6-dienyl)-1,3,8-trihydroxy-6-methyl-10H-anthracen-9-one.
| Compound Name | 10-[4,5-dihydroxy-2-methyl-7-(3-methylbut-2-enoxy)-10-oxo-9H-anthracen-9-yl]-2-(3,7-dimethylocta-2,6-dienyl)-1,3,8-trihydroxy-6-methyl-10H-anthracen-9-one |
|---|---|
| PubChem CID | 74323877 |
| Molecular Formula | C45H46O8 |
| Molecular Weight | 714.85 g/mol |
| Exact Mass | 714.32 |
| IUPAC Name | 10-[4,5-dihydroxy-2-methyl-7-(3-methylbut-2-enoxy)-10-oxo-9H-anthracen-9-yl]-2-(3,7-dimethylocta-2,6-dienyl)-1,3,8-trihydroxy-6-methyl-10H-anthracen-9-one |
| SMILES | CC(C)=CCCC(C)=CCc1c(O)cc2c(c1O)C(=O)c1c(O)cc(C)cc1C2C1c2cc(C)cc(O)c2C(=O)c2c(O)cc(OCC=C(C)C)cc21 |
| InChI | InChI=1S/C45H46O8/c1-22(2)9-8-10-24(5)11-12-28-33(46)21-32-38(30-16-26(7)18-35(48)40(30)45(52)42(32)43(28)50)37-29-15-25(6)17-34(47)39(29)44(51)41-31(37)19-27(20-36(41)49)53-14-13-23(3)4/h9,11,13,15-21,37-38,46-50H,8,10,12,14H2,1-7H3 |
| InChIKey | INQUOLZYEPOOMQ-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.85 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|