C25H28O7 — CID 162889151
3-[(6S)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]-1,8-dihydroxy-6-methylanthracene-9,10-dione (PubChem CID 162889151) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is 3-[(6S)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]-1,8-dihydroxy-6-methylanthracene-9,10-dione.
| Compound Name | 3-[(6S)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]-1,8-dihydroxy-6-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 162889151 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 3-[(6S)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]-1,8-dihydroxy-6-methylanthracene-9,10-dione |
| SMILES | CC(=CCOc1cc(O)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O)CC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C25H28O7/c1-13(5-6-20(28)25(3,4)31)7-8-32-15-11-17-22(19(27)12-15)24(30)21-16(23(17)29)9-14(2)10-18(21)26/h7,9-12,20,26-28,31H,5-6,8H2,1-4H3/t20-/m0/s1 |
| InChIKey | GBIUPAOEZBRMJF-FQEVSTJZSA-N |
| XLogP | 3.42 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|