C21H32O6 — CID 162816870
[(1S,2S,5S,8R,9R,10S,12R,14S)-10-hydroxy-5,9,14-trimethyl-4-oxo-3,13-dioxatetracyclo[7.5.0.02,6.012,14]tetradecan-8-yl] 3-methylpentanoate (PubChem CID 162816870) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is [(1S,2S,5S,8R,9R,10S,12R,14S)-10-hydroxy-5,9,14-trimethyl-4-oxo-3,13-dioxatetracyclo[7.5.0.02,6.012,14]tetradecan-8-yl] 3-methylpentanoate.
| Compound Name | [(1S,2S,5S,8R,9R,10S,12R,14S)-10-hydroxy-5,9,14-trimethyl-4-oxo-3,13-dioxatetracyclo[7.5.0.02,6.012,14]tetradecan-8-yl] 3-methylpentanoate |
|---|---|
| PubChem CID | 162816870 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [(1S,2S,5S,8R,9R,10S,12R,14S)-10-hydroxy-5,9,14-trimethyl-4-oxo-3,13-dioxatetracyclo[7.5.0.02,6.012,14]tetradecan-8-yl] 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)O[C@@H]1CC2[C@H](C)C(=O)O[C@@H]2[C@H]2[C@]3(C)O[C@@H]3C[C@H](O)[C@]12C |
| InChI | InChI=1S/C21H32O6/c1-6-10(2)7-16(23)25-14-8-12-11(3)19(24)26-17(12)18-20(14,4)13(22)9-15-21(18,5)27-15/h10-15,17-18,22H,6-9H2,1-5H3/t10?,11-,12?,13-,14+,15+,17-,18+,20+,21+/m0/s1 |
| InChIKey | QWKAKCREJKJTMQ-TVAZECOCSA-N |
| XLogP | 2.46 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|