C31H30O11 — CID 162817002
[(2S,3R,4S,5S)-6-[4,5-dihydroxy-2-(hydroxymethyl)-9-methyl-10-oxoanthracen-9-yl]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 162817002) has the molecular formula C31H30O11 and a molecular weight of 578.57 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-6-[4,5-dihydroxy-2-(hydroxymethyl)-9-methyl-10-oxoanthracen-9-yl]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2S,3R,4S,5S)-6-[4,5-dihydroxy-2-(hydroxymethyl)-9-methyl-10-oxoanthracen-9-yl]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162817002 |
| Molecular Formula | C31H30O11 |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | [(2S,3R,4S,5S)-6-[4,5-dihydroxy-2-(hydroxymethyl)-9-methyl-10-oxoanthracen-9-yl]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | CC1(C2O[C@@H](COC(=O)/C=C/c3ccc(O)cc3)[C@H](O)[C@@H](O)[C@@H]2O)c2cccc(O)c2C(=O)c2c(O)cc(CO)cc21 |
| InChI | InChI=1S/C31H30O11/c1-31(18-3-2-4-20(34)24(18)27(38)25-19(31)11-16(13-32)12-21(25)35)30-29(40)28(39)26(37)22(42-30)14-41-23(36)10-7-15-5-8-17(33)9-6-15/h2-12,22,26,28-30,32-35,37,39-40H,13-14H2,1H3/b10-7+/t22-,26-,28+,29-,30?,31?/m0/s1 |
| InChIKey | VZGSSLNWEFGKFM-XNYBVMJWSA-N |
| XLogP | 1.25 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|