C16H20O5 — CID 162817354
[(1R,2E,6E)-7-methyl-1-[(3R)-4-methylidene-5-oxooxolan-3-yl]-8-oxoocta-2,6-dienyl] acetate (PubChem CID 162817354) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is [(1R,2E,6E)-7-methyl-1-[(3R)-4-methylidene-5-oxooxolan-3-yl]-8-oxoocta-2,6-dienyl] acetate.
| Compound Name | [(1R,2E,6E)-7-methyl-1-[(3R)-4-methylidene-5-oxooxolan-3-yl]-8-oxoocta-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 162817354 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [(1R,2E,6E)-7-methyl-1-[(3R)-4-methylidene-5-oxooxolan-3-yl]-8-oxoocta-2,6-dienyl] acetate |
| SMILES | C=C1C(=O)OC[C@@H]1[C@@H](/C=C/CC/C=C(\C)C=O)OC(C)=O |
| InChI | InChI=1S/C16H20O5/c1-11(9-17)7-5-4-6-8-15(21-13(3)18)14-10-20-16(19)12(14)2/h6-9,14-15H,2,4-5,10H2,1,3H3/b8-6+,11-7+/t14-,15+/m0/s1 |
| InChIKey | JUCUZVFPWCOXDO-ITIQLNCPSA-N |
| XLogP | 2.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|