C20H28O — CID 162817405
(E,3S)-icos-4-en-1,14,19-triyn-3-ol (PubChem CID 162817405) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (E,3S)-icos-4-en-1,14,19-triyn-3-ol.
| Compound Name | (E,3S)-icos-4-en-1,14,19-triyn-3-ol |
|---|---|
| PubChem CID | 162817405 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (E,3S)-icos-4-en-1,14,19-triyn-3-ol |
| SMILES | C#CCCCC#CCCCCCCCC/C=C/[C@H](O)C#C |
| InChI | InChI=1S/C20H28O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)4-2/h1-2,18-21H,5-7,10-17H2/b19-18+/t20-/m1/s1 |
| InChIKey | HKCQWELWYDDSMN-LNEUUDGLSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|