C19H23NO4 — CID 162817592
18-methoxy-11,15-dimethyl-5,7,12-trioxa-15-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene (PubChem CID 162817592) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 18-methoxy-11,15-dimethyl-5,7,12-trioxa-15-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene.
| Compound Name | 18-methoxy-11,15-dimethyl-5,7,12-trioxa-15-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene |
|---|---|
| PubChem CID | 162817592 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 18-methoxy-11,15-dimethyl-5,7,12-trioxa-15-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene |
| SMILES | COC1C=CC23c4cc5c(cc4C(C)OC2CN(C)C3C1)OCO5 |
| InChI | InChI=1S/C19H23NO4/c1-11-13-7-15-16(23-10-22-15)8-14(13)19-5-4-12(21-3)6-17(19)20(2)9-18(19)24-11/h4-5,7-8,11-12,17-18H,6,9-10H2,1-3H3 |
| InChIKey | BEUAXUHESIYYCT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|