C23H25N3O7 — CID 98657409
6-hydroxy-5-[(1S,11S,13R,15S,18R)-18-hydroxy-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-11-yl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 98657409) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is 6-hydroxy-5-[(1S,11S,13R,15S,18R)-18-hydroxy-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-11-yl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(1S,11S,13R,15S,18R)-18-hydroxy-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-11-yl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 98657409 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 6-hydroxy-5-[(1S,11S,13R,15S,18R)-18-hydroxy-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-11-yl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CO[C@@H]1C=C[C@@]23c4cc5c(cc4[C@@H](c4c(O)n(C)c(=O)n(C)c4=O)N(C[C@@H]2O)[C@@H]3C1)OCO5 |
| InChI | InChI=1S/C23H25N3O7/c1-24-20(28)18(21(29)25(2)22(24)30)19-12-7-14-15(33-10-32-14)8-13(12)23-5-4-11(31-3)6-16(23)26(19)9-17(23)27/h4-5,7-8,11,16-17,19,27-28H,6,9-10H2,1-3H3/t11-,16-,17+,19+,23+/m1/s1 |
| InChIKey | WUGZVVSUKLMSKB-ONOHEDCGSA-N |
| XLogP | -0.12 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|