C18H22ClNO5 — CID 71511252
(1R,11S,12R,13R,15R,18S)-15-methoxy-12-methyl-5,7-dioxa-12-azoniapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraene-11,18-diol chloride (PubChem CID 71511252) has the molecular formula C18H22ClNO5 and a molecular weight of 367.83 g/mol. Its IUPAC name is (1R,11S,12R,13R,15R,18S)-15-methoxy-12-methyl-5,7-dioxa-12-azoniapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraene-11,18-diol chloride.
| Compound Name | (1R,11S,12R,13R,15R,18S)-15-methoxy-12-methyl-5,7-dioxa-12-azoniapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraene-11,18-diol chloride |
|---|---|
| PubChem CID | 71511252 |
| Molecular Formula | C18H22ClNO5 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (1R,11S,12R,13R,15R,18S)-15-methoxy-12-methyl-5,7-dioxa-12-azoniapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraene-11,18-diol chloride |
| SMILES | CO[C@H]1C=C[C@]23c4cc5c(cc4[C@H](O)[N@+](C)(C[C@H]2O)[C@@H]3C1)OCO5.[Cl-] |
| InChI | InChI=1S/C18H22NO5.ClH/c1-19-8-16(20)18(4-3-10(22-2)5-15(18)19)12-7-14-13(23-9-24-14)6-11(12)17(19)21;/h3-4,6-7,10,15-17,20-21H,5,8-9H2,1-2H3;1H/q+1;/p-1/t10-,15+,16+,17-,18+,19+;/m0./s1 |
| InChIKey | HREBYEGWZXGGQO-KWOURYKHSA-M |
| XLogP | -2.17 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|