C35H52O6 — CID 162817730
20-hydroxy-7,8,14,15,19,19-hexamethyl-10-(2-methylbut-2-enoyloxy)-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracos-4-ene-11-carboxylic acid (PubChem CID 162817730) has the molecular formula C35H52O6 and a molecular weight of 568.80 g/mol. Its IUPAC name is 20-hydroxy-7,8,14,15,19,19-hexamethyl-10-(2-methylbut-2-enoyloxy)-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracos-4-ene-11-carboxylic acid.
| Compound Name | 20-hydroxy-7,8,14,15,19,19-hexamethyl-10-(2-methylbut-2-enoyloxy)-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracos-4-ene-11-carboxylic acid |
|---|---|
| PubChem CID | 162817730 |
| Molecular Formula | C35H52O6 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.38 |
| IUPAC Name | 20-hydroxy-7,8,14,15,19,19-hexamethyl-10-(2-methylbut-2-enoyloxy)-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracos-4-ene-11-carboxylic acid |
| SMILES | CC=C(C)C(=O)OC1CC(C)C(C)C2C3=CCC4C56CCC(O)(OC5)C(C)(C)C6CCC4(C)C3(C)CCC12C(=O)O |
| InChI | InChI=1S/C35H52O6/c1-9-20(2)28(36)41-26-18-21(3)22(4)27-23-10-11-25-32(8,31(23,7)14-16-34(26,27)29(37)38)13-12-24-30(5,6)35(39)17-15-33(24,25)19-40-35/h9-10,21-22,24-27,39H,11-19H2,1-8H3,(H,37,38) |
| InChIKey | ZZUXMBOSLJTUDZ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|