C34H50O6 — CID 162912534
(1S,2S,6S,10R,11S,14S,15R,18S,20S)-20-hydroxy-8,8,14,15,19,19-hexamethyl-10-[(Z)-2-methylbut-2-enoyl]oxy-23-oxahexacyclo[18.2.1.01,18.02,15.05,14.06,11]tricos-4-ene-11-carboxylic acid (PubChem CID 162912534) has the molecular formula C34H50O6 and a molecular weight of 554.77 g/mol. Its IUPAC name is (1S,2S,6S,10R,11S,14S,15R,18S,20S)-20-hydroxy-8,8,14,15,19,19-hexamethyl-10-[(Z)-2-methylbut-2-enoyl]oxy-23-oxahexacyclo[18.2.1.01,18.02,15.05,14.06,11]tricos-4-ene-11-carboxylic acid.
| Compound Name | (1S,2S,6S,10R,11S,14S,15R,18S,20S)-20-hydroxy-8,8,14,15,19,19-hexamethyl-10-[(Z)-2-methylbut-2-enoyl]oxy-23-oxahexacyclo[18.2.1.01,18.02,15.05,14.06,11]tricos-4-ene-11-carboxylic acid |
|---|---|
| PubChem CID | 162912534 |
| Molecular Formula | C34H50O6 |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | (1S,2S,6S,10R,11S,14S,15R,18S,20S)-20-hydroxy-8,8,14,15,19,19-hexamethyl-10-[(Z)-2-methylbut-2-enoyl]oxy-23-oxahexacyclo[18.2.1.01,18.02,15.05,14.06,11]tricos-4-ene-11-carboxylic acid |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1CC(C)(C)C[C@H]2C3=CC[C@@H]4[C@]56CC[C@](O)(O5)C(C)(C)[C@@H]6CC[C@@]4(C)[C@]3(C)CC[C@@]12C(=O)O |
| InChI | InChI=1S/C34H50O6/c1-9-20(2)26(35)39-25-19-28(3,4)18-22-21-10-11-24-31(8,30(21,7)14-15-32(22,25)27(36)37)13-12-23-29(5,6)34(38)17-16-33(23,24)40-34/h9-10,22-25,38H,11-19H2,1-8H3,(H,36,37)/b20-9-/t22-,23-,24-,25+,30+,31+,32-,33+,34-/m0/s1 |
| InChIKey | DJIAUMWQRRBXNT-IQNJHLSNSA-N |
| XLogP | 6.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|