C35H54O5 — CID 10076355
(4R,4aS,6aS,6bR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-4-(2-methylbutanoyloxy)-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid (PubChem CID 10076355) has the molecular formula C35H54O5 and a molecular weight of 554.81 g/mol. Its IUPAC name is (4R,4aS,6aS,6bR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-4-(2-methylbutanoyloxy)-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid.
| Compound Name | (4R,4aS,6aS,6bR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-4-(2-methylbutanoyloxy)-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 10076355 |
| Molecular Formula | C35H54O5 |
| Molecular Weight | 554.81 g/mol |
| Exact Mass | 554.40 |
| IUPAC Name | (4R,4aS,6aS,6bR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-4-(2-methylbutanoyloxy)-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid |
| SMILES | CCC(C)C(=O)O[C@@H]1CC(C)(C)C[C@H]2C3=CCC4[C@@]5(C)CCC(=O)C(C)(C)C5CC[C@@]4(C)[C@]3(C)CC[C@@]12C(=O)O |
| InChI | InChI=1S/C35H54O5/c1-10-21(2)28(37)40-27-20-30(3,4)19-23-22-11-12-25-32(7)15-14-26(36)31(5,6)24(32)13-16-34(25,9)33(22,8)17-18-35(23,27)29(38)39/h11,21,23-25,27H,10,12-20H2,1-9H3,(H,38,39)/t21?,23-,24?,25?,27+,32-,33+,34+,35-/m0/s1 |
| InChIKey | KVXZSWTXYDUXID-XHZRLFMLSA-N |
| XLogP | 8.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.81 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|