C30H47NO4 — CID 165437383
(4R,4aS,6aS,6bR,10E,12aR)-4-hydroxy-10-hydroxyimino-2,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid (PubChem CID 165437383) has the molecular formula C30H47NO4 and a molecular weight of 485.71 g/mol. Its IUPAC name is (4R,4aS,6aS,6bR,10E,12aR)-4-hydroxy-10-hydroxyimino-2,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid.
| Compound Name | (4R,4aS,6aS,6bR,10E,12aR)-4-hydroxy-10-hydroxyimino-2,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 165437383 |
| Molecular Formula | C30H47NO4 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.35 |
| IUPAC Name | (4R,4aS,6aS,6bR,10E,12aR)-4-hydroxy-10-hydroxyimino-2,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid |
| SMILES | CC1(C)CC2C3=CCC4[C@@]5(C)CC/C(=N\O)C(C)(C)C5CC[C@@]4(C)[C@]3(C)CC[C@@]2(C(=O)O)[C@H](O)C1 |
| InChI | InChI=1S/C30H47NO4/c1-25(2)16-19-18-8-9-21-27(5)12-11-22(31-35)26(3,4)20(27)10-13-29(21,7)28(18,6)14-15-30(19,24(33)34)23(32)17-25/h8,19-21,23,32,35H,9-17H2,1-7H3,(H,33,34)/b31-22+/t19?,20?,21?,23-,27+,28-,29-,30+/m1/s1 |
| InChIKey | ABZCSJWNWQFWHL-KLDOQDBNSA-N |
| XLogP | 6.67 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|