C20H26O3 — CID 162817975
(1R,3R,4aS,10aR)-3-hydroxy-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 162817975) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (1R,3R,4aS,10aR)-3-hydroxy-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,3R,4aS,10aR)-3-hydroxy-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 162817975 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (1R,3R,4aS,10aR)-3-hydroxy-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | C=C(C)c1ccc2c(c1)CC[C@H]1[C@](C)(C(=O)O)C[C@H](O)C[C@]21C |
| InChI | InChI=1S/C20H26O3/c1-12(2)13-5-7-16-14(9-13)6-8-17-19(16,3)10-15(21)11-20(17,4)18(22)23/h5,7,9,15,17,21H,1,6,8,10-11H2,2-4H3,(H,22,23)/t15-,17-,19-,20-/m1/s1 |
| InChIKey | POJDCRLKFHLPDK-RARDXLECSA-N |
| XLogP | 3.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |