C28H32O12 — CID 162819495
[3,5-diacetyloxy-2-[[10-hydroxy-2-(hydroxymethyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] 3-phenylprop-2-enoate (PubChem CID 162819495) has the molecular formula C28H32O12 and a molecular weight of 560.55 g/mol. Its IUPAC name is [3,5-diacetyloxy-2-[[10-hydroxy-2-(hydroxymethyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] 3-phenylprop-2-enoate.
| Compound Name | [3,5-diacetyloxy-2-[[10-hydroxy-2-(hydroxymethyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162819495 |
| Molecular Formula | C28H32O12 |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | [3,5-diacetyloxy-2-[[10-hydroxy-2-(hydroxymethyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] 3-phenylprop-2-enoate |
| SMILES | CC(=O)OC1C(C)OC(OC2C3C=COC(O)C3C3(CO)OC23)C(OC(C)=O)C1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C28H32O12/c1-14-21(36-15(2)30)23(38-19(32)10-9-17-7-5-4-6-8-17)24(37-16(3)31)27(35-14)39-22-18-11-12-34-26(33)20(18)28(13-29)25(22)40-28/h4-12,14,18,20-27,29,33H,13H2,1-3H3 |
| InChIKey | IDAIKLBZYZJEHE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 159.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|