C32H40O15 — CID 163011381
[5-acetyloxy-3-hydroxy-2-methyl-6-[[10-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)cyclohexyl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]oxan-4-yl] 3-phenylprop-2-enoate (PubChem CID 163011381) has the molecular formula C32H40O15 and a molecular weight of 664.66 g/mol. Its IUPAC name is [5-acetyloxy-3-hydroxy-2-methyl-6-[[10-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)cyclohexyl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]oxan-4-yl] 3-phenylprop-2-enoate.
| Compound Name | [5-acetyloxy-3-hydroxy-2-methyl-6-[[10-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)cyclohexyl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]oxan-4-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 163011381 |
| Molecular Formula | C32H40O15 |
| Molecular Weight | 664.66 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | [5-acetyloxy-3-hydroxy-2-methyl-6-[[10-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)cyclohexyl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]oxan-4-yl] 3-phenylprop-2-enoate |
| SMILES | CC(=O)OC1C(OC2C3C=COC(OC4C(O)C(O)C(O)C(O)C4CO)C3C3OC23)OC(C)C(O)C1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C32H40O15/c1-13-20(36)28(44-18(35)9-8-15-6-4-3-5-7-15)30(43-14(2)34)32(42-13)47-26-16-10-11-41-31(19(16)27-29(26)45-27)46-25-17(12-33)21(37)22(38)23(39)24(25)40/h3-11,13,16-17,19-33,36-40H,12H2,1-2H3 |
| InChIKey | PODSZKKKICCJAM-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 223.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.66 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|