C19H34O4 — CID 162820198
5-dec-9-enyl-3-(2,3-dimethoxypropyl)oxolan-2-one (PubChem CID 162820198) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is 5-dec-9-enyl-3-(2,3-dimethoxypropyl)oxolan-2-one.
| Compound Name | 5-dec-9-enyl-3-(2,3-dimethoxypropyl)oxolan-2-one |
|---|---|
| PubChem CID | 162820198 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 5-dec-9-enyl-3-(2,3-dimethoxypropyl)oxolan-2-one |
| SMILES | C=CCCCCCCCCC1CC(CC(COC)OC)C(=O)O1 |
| InChI | InChI=1S/C19H34O4/c1-4-5-6-7-8-9-10-11-12-17-13-16(19(20)23-17)14-18(22-3)15-21-2/h4,16-18H,1,5-15H2,2-3H3 |
| InChIKey | FTGCKUMDSDOOLW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|