C27H40O7 — CID 162820329
[(2R,3R,4R,5R,8R,9R,10R,13R,14S,17S)-3,4-diacetyloxy-17-ethyl-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate (PubChem CID 162820329) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is [(2R,3R,4R,5R,8R,9R,10R,13R,14S,17S)-3,4-diacetyloxy-17-ethyl-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate.
| Compound Name | [(2R,3R,4R,5R,8R,9R,10R,13R,14S,17S)-3,4-diacetyloxy-17-ethyl-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 162820329 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | [(2R,3R,4R,5R,8R,9R,10R,13R,14S,17S)-3,4-diacetyloxy-17-ethyl-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate |
| SMILES | CC[C@@H]1C(=O)C[C@H]2[C@@H]3CC[C@H]4[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)C[C@]4(C)[C@@H]3CC[C@@]12C |
| InChI | InChI=1S/C27H40O7/c1-7-18-22(31)12-21-17-8-9-20-24(33-15(3)29)25(34-16(4)30)23(32-14(2)28)13-27(20,6)19(17)10-11-26(18,21)5/h17-21,23-25H,7-13H2,1-6H3/t17-,18-,19-,20+,21+,23-,24-,25-,26+,27-/m1/s1 |
| InChIKey | PLZPNDBFLGCZTJ-FMIAYOFASA-N |
| XLogP | 4.25 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|