C22H36O3 — CID 162902169
17-ethyl-3-hydroxy-2-methoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-one (PubChem CID 162902169) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 17-ethyl-3-hydroxy-2-methoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | 17-ethyl-3-hydroxy-2-methoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 162902169 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 17-ethyl-3-hydroxy-2-methoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-one |
| SMILES | CCC1C(=O)CC2C3CCC4CC(O)C(OC)CC4(C)C3CCC12C |
| InChI | InChI=1S/C22H36O3/c1-5-15-18(23)11-17-14-7-6-13-10-19(24)20(25-4)12-22(13,3)16(14)8-9-21(15,17)2/h13-17,19-20,24H,5-12H2,1-4H3 |
| InChIKey | VSYFJHFESQENRE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |