C21H34O3 — CID 162820437
methyl 2-[(1S,2S)-2-[(1R,4S)-4-ethenyl-4-methyl-2-oxocyclohexyl]-2,6,6-trimethylcyclohexyl]acetate (PubChem CID 162820437) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is methyl 2-[(1S,2S)-2-[(1R,4S)-4-ethenyl-4-methyl-2-oxocyclohexyl]-2,6,6-trimethylcyclohexyl]acetate.
| Compound Name | methyl 2-[(1S,2S)-2-[(1R,4S)-4-ethenyl-4-methyl-2-oxocyclohexyl]-2,6,6-trimethylcyclohexyl]acetate |
|---|---|
| PubChem CID | 162820437 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | methyl 2-[(1S,2S)-2-[(1R,4S)-4-ethenyl-4-methyl-2-oxocyclohexyl]-2,6,6-trimethylcyclohexyl]acetate |
| SMILES | C=C[C@@]1(C)CC[C@H]([C@@]2(C)CCCC(C)(C)[C@@H]2CC(=O)OC)C(=O)C1 |
| InChI | InChI=1S/C21H34O3/c1-7-20(4)12-9-15(16(22)14-20)21(5)11-8-10-19(2,3)17(21)13-18(23)24-6/h7,15,17H,1,8-14H2,2-6H3/t15-,17-,20-,21+/m0/s1 |
| InChIKey | LDVSXMCXDQWZKB-STRKUORWSA-N |
| XLogP | 4.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|