C22H24N2O4 — CID 162820863
2-[[1,4-bis(4-methoxyphenyl)-3-(2-oxoethylamino)buta-1,3-dien-2-yl]amino]acetaldehyde (PubChem CID 162820863) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-[[1,4-bis(4-methoxyphenyl)-3-(2-oxoethylamino)buta-1,3-dien-2-yl]amino]acetaldehyde.
| Compound Name | 2-[[1,4-bis(4-methoxyphenyl)-3-(2-oxoethylamino)buta-1,3-dien-2-yl]amino]acetaldehyde |
|---|---|
| PubChem CID | 162820863 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[[1,4-bis(4-methoxyphenyl)-3-(2-oxoethylamino)buta-1,3-dien-2-yl]amino]acetaldehyde |
| SMILES | COc1ccc(C=C(NCC=O)C(=Cc2ccc(OC)cc2)NCC=O)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-27-19-7-3-17(4-8-19)15-21(23-11-13-25)22(24-12-14-26)16-18-5-9-20(28-2)10-6-18/h3-10,13-16,23-24H,11-12H2,1-2H3 |
| InChIKey | CANFGZPBMRPWIS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|