C28H48O3 — CID 162821380
7-(4-hydroxy-6-methylheptan-2-yl)-4a,6a-dimethyl-1,2,3,4,6,7,8,9,10,10a,10b,11,12,12a-tetradecahydrochrysene-2,12-diol (PubChem CID 162821380) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is 7-(4-hydroxy-6-methylheptan-2-yl)-4a,6a-dimethyl-1,2,3,4,6,7,8,9,10,10a,10b,11,12,12a-tetradecahydrochrysene-2,12-diol.
| Compound Name | 7-(4-hydroxy-6-methylheptan-2-yl)-4a,6a-dimethyl-1,2,3,4,6,7,8,9,10,10a,10b,11,12,12a-tetradecahydrochrysene-2,12-diol |
|---|---|
| PubChem CID | 162821380 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | 7-(4-hydroxy-6-methylheptan-2-yl)-4a,6a-dimethyl-1,2,3,4,6,7,8,9,10,10a,10b,11,12,12a-tetradecahydrochrysene-2,12-diol |
| SMILES | CC(C)CC(O)CC(C)C1CCCC2C3CC(O)C4CC(O)CCC4(C)C3=CCC12C |
| InChI | InChI=1S/C28H48O3/c1-17(2)13-20(30)14-18(3)22-7-6-8-23-21-16-26(31)25-15-19(29)9-11-28(25,5)24(21)10-12-27(22,23)4/h10,17-23,25-26,29-31H,6-9,11-16H2,1-5H3 |
| InChIKey | NCBNYFAKBWFMMC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|