C27H46O3 — CID 71437490
17-(4-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol (PubChem CID 71437490) has the molecular formula C27H46O3 and a molecular weight of 418.66 g/mol. Its IUPAC name is 17-(4-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol.
| Compound Name | 17-(4-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol |
|---|---|
| PubChem CID | 71437490 |
| Molecular Formula | C27H46O3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | 17-(4-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol |
| SMILES | CC(C)CC(O)CC(C)C1CCC2C3CC(O)C4CC(O)CCC4(C)C3=CCC12C |
| InChI | InChI=1S/C27H46O3/c1-16(2)12-19(29)13-17(3)21-6-7-22-20-15-25(30)24-14-18(28)8-10-27(24,5)23(20)9-11-26(21,22)4/h9,16-22,24-25,28-30H,6-8,10-15H2,1-5H3 |
| InChIKey | NXLPNFCDYLPKSA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|