C21H23F3N2O — CID 162822876
3-(2-benzhydrylpyrrolidin-1-yl)imino-1,1,1-trifluoro-2-methylpropan-2-ol (PubChem CID 162822876) has the molecular formula C21H23F3N2O and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-(2-benzhydrylpyrrolidin-1-yl)imino-1,1,1-trifluoro-2-methylpropan-2-ol.
| Compound Name | 3-(2-benzhydrylpyrrolidin-1-yl)imino-1,1,1-trifluoro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 162822876 |
| Molecular Formula | C21H23F3N2O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-(2-benzhydrylpyrrolidin-1-yl)imino-1,1,1-trifluoro-2-methylpropan-2-ol |
| SMILES | CC(O)(C=NN1CCCC1C(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H23F3N2O/c1-20(27,21(22,23)24)15-25-26-14-8-13-18(26)19(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,15,18-19,27H,8,13-14H2,1H3 |
| InChIKey | PVVKPBCVQNVNJW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|