C27H27F3N2O — CID 177487431
(2R)-2-[(E)-[(2S)-2-benzhydrylpyrrolidin-1-yl]iminomethyl]-1,1,1-trifluoro-3-phenylpropan-2-ol (PubChem CID 177487431) has the molecular formula C27H27F3N2O and a molecular weight of 452.52 g/mol. Its IUPAC name is (2R)-2-[(E)-[(2S)-2-benzhydrylpyrrolidin-1-yl]iminomethyl]-1,1,1-trifluoro-3-phenylpropan-2-ol.
| Compound Name | (2R)-2-[(E)-[(2S)-2-benzhydrylpyrrolidin-1-yl]iminomethyl]-1,1,1-trifluoro-3-phenylpropan-2-ol |
|---|---|
| PubChem CID | 177487431 |
| Molecular Formula | C27H27F3N2O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (2R)-2-[(E)-[(2S)-2-benzhydrylpyrrolidin-1-yl]iminomethyl]-1,1,1-trifluoro-3-phenylpropan-2-ol |
| SMILES | O[C@@](/C=N/N1CCC[C@H]1C(c1ccccc1)c1ccccc1)(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C27H27F3N2O/c28-27(29,30)26(33,19-21-11-4-1-5-12-21)20-31-32-18-10-17-24(32)25(22-13-6-2-7-14-22)23-15-8-3-9-16-23/h1-9,11-16,20,24-25,33H,10,17-19H2/b31-20+/t24-,26+/m0/s1 |
| InChIKey | MMDAKLXSGGTPQH-HXCDFWTDSA-N |
| XLogP | 5.80 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|