C28H38N2O — CID 142080675
[(1R)-4-(2-aminoethyl)cyclooctyl]-[(2S)-2-benzhydrylpyrrolidin-1-yl]methanone (PubChem CID 142080675) has the molecular formula C28H38N2O and a molecular weight of 418.63 g/mol. Its IUPAC name is [(1R)-4-(2-aminoethyl)cyclooctyl]-[(2S)-2-benzhydrylpyrrolidin-1-yl]methanone.
| Compound Name | [(1R)-4-(2-aminoethyl)cyclooctyl]-[(2S)-2-benzhydrylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 142080675 |
| Molecular Formula | C28H38N2O |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.30 |
| IUPAC Name | [(1R)-4-(2-aminoethyl)cyclooctyl]-[(2S)-2-benzhydrylpyrrolidin-1-yl]methanone |
| SMILES | NCCC1CCCC[C@@H](C(=O)N2CCC[C@H]2C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H38N2O/c29-20-19-22-10-7-8-15-25(18-17-22)28(31)30-21-9-16-26(30)27(23-11-3-1-4-12-23)24-13-5-2-6-14-24/h1-6,11-14,22,25-27H,7-10,15-21,29H2/t22?,25-,26+/m1/s1 |
| InChIKey | BTDAQAUUXNZVNB-DVSPJEKPSA-N |
| XLogP | 5.74 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |