C22H25MnN2O- — CID 145485125
[(2S)-2-benzhydrylpyrrolidin-1-yl]-[(2S)-pyrrolidin-4-id-2-yl]methanone;manganese (PubChem CID 145485125) has the molecular formula C22H25MnN2O- and a molecular weight of 388.39 g/mol. Its IUPAC name is [(2S)-2-benzhydrylpyrrolidin-1-yl]-[(2S)-pyrrolidin-4-id-2-yl]methanone;manganese.
| Compound Name | [(2S)-2-benzhydrylpyrrolidin-1-yl]-[(2S)-pyrrolidin-4-id-2-yl]methanone;manganese |
|---|---|
| PubChem CID | 145485125 |
| Molecular Formula | C22H25MnN2O- |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [(2S)-2-benzhydrylpyrrolidin-1-yl]-[(2S)-pyrrolidin-4-id-2-yl]methanone;manganese |
| SMILES | O=C([C@@H]1C[CH-]CN1)N1CCC[C@H]1C(c1ccccc1)c1ccccc1.[Mn] |
| InChI | InChI=1S/C22H25N2O.Mn/c25-22(19-13-7-15-23-19)24-16-8-14-20(24)21(17-9-3-1-4-10-17)18-11-5-2-6-12-18;/h1-7,9-12,19-21,23H,8,13-16H2;/q-1;/t19-,20-;/m0./s1 |
| InChIKey | WORZANICIKKSEA-FKLPMGAJSA-N |
| XLogP | 3.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|