C35H50O7 — CID 162823785
2,3,14-trihydroxy-17-[1-hydroxy-1-[3-(3-methylbutan-2-yl)oxiran-2-yl]ethyl]-13-[2-(3-hydroxyphenyl)ethyl]-10-methyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 162823785) has the molecular formula C35H50O7 and a molecular weight of 582.78 g/mol. Its IUPAC name is 2,3,14-trihydroxy-17-[1-hydroxy-1-[3-(3-methylbutan-2-yl)oxiran-2-yl]ethyl]-13-[2-(3-hydroxyphenyl)ethyl]-10-methyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | 2,3,14-trihydroxy-17-[1-hydroxy-1-[3-(3-methylbutan-2-yl)oxiran-2-yl]ethyl]-13-[2-(3-hydroxyphenyl)ethyl]-10-methyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 162823785 |
| Molecular Formula | C35H50O7 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | 2,3,14-trihydroxy-17-[1-hydroxy-1-[3-(3-methylbutan-2-yl)oxiran-2-yl]ethyl]-13-[2-(3-hydroxyphenyl)ethyl]-10-methyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC(C)C(C)C1OC1C(C)(O)C1CCC2(O)C3=CC(=O)C4CC(O)C(O)CC4(C)C3CCC12CCc1cccc(O)c1 |
| InChI | InChI=1S/C35H50O7/c1-19(2)20(3)30-31(42-30)33(5,40)29-11-14-35(41)24-16-26(37)25-17-27(38)28(39)18-32(25,4)23(24)10-13-34(29,35)12-9-21-7-6-8-22(36)15-21/h6-8,15-16,19-20,23,25,27-31,36,38-41H,9-14,17-18H2,1-5H3 |
| InChIKey | NZEUZMSKWHHQKG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|