C24H27N3O10 — CID 162827258
2-[[4-(2-hydroxyethoxy)-9,10-dioxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]guanidine (PubChem CID 162827258) has the molecular formula C24H27N3O10 and a molecular weight of 517.49 g/mol. Its IUPAC name is 2-[[4-(2-hydroxyethoxy)-9,10-dioxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]guanidine.
| Compound Name | 2-[[4-(2-hydroxyethoxy)-9,10-dioxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 162827258 |
| Molecular Formula | C24H27N3O10 |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 2-[[4-(2-hydroxyethoxy)-9,10-dioxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]guanidine |
| SMILES | NC(N)=NCc1cc2c(c(OCCO)c1OC1OC(CO)C(O)C(O)C1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H27N3O10/c25-24(26)27-8-10-7-13-15(17(31)12-4-2-1-3-11(12)16(13)30)22(35-6-5-28)21(10)37-23-20(34)19(33)18(32)14(9-29)36-23/h1-4,7,14,18-20,23,28-29,32-34H,5-6,8-9H2,(H4,25,26,27) |
| InChIKey | YKTSRQSCTCKYIB-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 227.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|