C27H31N3O9 — CID 163083012
2-[[4-hydroxy-9,10-dioxo-3-[3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxyanthracen-2-yl]methyl]guanidine (PubChem CID 163083012) has the molecular formula C27H31N3O9 and a molecular weight of 541.56 g/mol. Its IUPAC name is 2-[[4-hydroxy-9,10-dioxo-3-[3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxyanthracen-2-yl]methyl]guanidine.
| Compound Name | 2-[[4-hydroxy-9,10-dioxo-3-[3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxyanthracen-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 163083012 |
| Molecular Formula | C27H31N3O9 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 2-[[4-hydroxy-9,10-dioxo-3-[3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxyanthracen-2-yl]methyl]guanidine |
| SMILES | NC(N)=NCc1cc2c(c(O)c1OC1OC(C3(O)CCCCC3)C(O)C(O)C1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H31N3O9/c28-26(29)30-11-12-10-15-16(18(32)14-7-3-2-6-13(14)17(15)31)19(33)23(12)38-25-22(36)20(34)21(35)24(39-25)27(37)8-4-1-5-9-27/h2-3,6-7,10,20-22,24-25,33-37H,1,4-5,8-9,11H2,(H4,28,29,30) |
| InChIKey | UVMGUQFQLVSAPS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 218.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|