C40H44O10 — CID 163031509
5-hydroxy-7-methyl-6-[3-[2-(2-phenylethyl)phenyl]propanoyl]-4-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid (PubChem CID 163031509) has the molecular formula C40H44O10 and a molecular weight of 684.78 g/mol. Its IUPAC name is 5-hydroxy-7-methyl-6-[3-[2-(2-phenylethyl)phenyl]propanoyl]-4-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid.
| Compound Name | 5-hydroxy-7-methyl-6-[3-[2-(2-phenylethyl)phenyl]propanoyl]-4-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 163031509 |
| Molecular Formula | C40H44O10 |
| Molecular Weight | 684.78 g/mol |
| Exact Mass | 684.29 |
| IUPAC Name | 5-hydroxy-7-methyl-6-[3-[2-(2-phenylethyl)phenyl]propanoyl]-4-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid |
| SMILES | Cc1cc2cc(C(=O)O)cc(O[C@@H]3O[C@H](C4(O)CCCCC4)[C@@H](O)[C@H](O)[C@H]3O)c2c(O)c1C(=O)CCc1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C40H44O10/c1-23-20-27-21-28(38(46)47)22-30(49-39-36(45)34(43)35(44)37(50-39)40(48)18-8-3-9-19-40)32(27)33(42)31(23)29(41)17-16-26-13-7-6-12-25(26)15-14-24-10-4-2-5-11-24/h2,4-7,10-13,20-22,34-37,39,42-45,48H,3,8-9,14-19H2,1H3,(H,46,47)/t34-,35-,36+,37-,39+/m0/s1 |
| InChIKey | AOYWETSWDSKOJZ-HAHISVAYSA-N |
| XLogP | 5.03 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.78 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |