C29H32O11 — CID 162849654
4-[(2S,3R,4R,5R,6R)-5-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,8-dihydroxy-7-methyl-6-(3-phenylpropanoyl)naphthalene-2-carboxylic acid (PubChem CID 162849654) has the molecular formula C29H32O11 and a molecular weight of 556.56 g/mol. Its IUPAC name is 4-[(2S,3R,4R,5R,6R)-5-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,8-dihydroxy-7-methyl-6-(3-phenylpropanoyl)naphthalene-2-carboxylic acid.
| Compound Name | 4-[(2S,3R,4R,5R,6R)-5-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,8-dihydroxy-7-methyl-6-(3-phenylpropanoyl)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 162849654 |
| Molecular Formula | C29H32O11 |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 4-[(2S,3R,4R,5R,6R)-5-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,8-dihydroxy-7-methyl-6-(3-phenylpropanoyl)naphthalene-2-carboxylic acid |
| SMILES | CC[C@@]1(O)[C@H](O)[C@@H](O)[C@H](Oc2cc(C(=O)O)cc3c(O)c(C)c(C(=O)CCc4ccccc4)c(O)c23)O[C@@H]1CO |
| InChI | InChI=1S/C29H32O11/c1-3-29(38)20(13-30)40-28(25(34)26(29)35)39-19-12-16(27(36)37)11-17-22(19)24(33)21(14(2)23(17)32)18(31)10-9-15-7-5-4-6-8-15/h4-8,11-12,20,25-26,28,30,32-35,38H,3,9-10,13H2,1-2H3,(H,36,37)/t20-,25-,26-,28-,29+/m1/s1 |
| InChIKey | UOFDKAJRZWATKD-UZDMEVRRSA-N |
| XLogP | 2.03 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|