C37H40O10 — CID 163097312
5-hydroxy-7-methyl-6-[3-[2-[(2R)-1-phenylbutan-2-yl]phenyl]propanoyl]-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid (PubChem CID 163097312) has the molecular formula C37H40O10 and a molecular weight of 644.72 g/mol. Its IUPAC name is 5-hydroxy-7-methyl-6-[3-[2-[(2R)-1-phenylbutan-2-yl]phenyl]propanoyl]-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid.
| Compound Name | 5-hydroxy-7-methyl-6-[3-[2-[(2R)-1-phenylbutan-2-yl]phenyl]propanoyl]-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 163097312 |
| Molecular Formula | C37H40O10 |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 5-hydroxy-7-methyl-6-[3-[2-[(2R)-1-phenylbutan-2-yl]phenyl]propanoyl]-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid |
| SMILES | CC[C@H](Cc1ccccc1)c1ccccc1CCC(=O)c1c(C)cc2cc(C(=O)O)cc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2c1O |
| InChI | InChI=1S/C37H40O10/c1-3-22(16-21-9-5-4-6-10-21)26-12-8-7-11-23(26)13-14-27(39)30-20(2)15-24-17-25(36(44)45)18-28(31(24)33(30)41)46-37-35(43)34(42)32(40)29(19-38)47-37/h4-12,15,17-18,22,29,32,34-35,37-38,40-43H,3,13-14,16,19H2,1-2H3,(H,44,45)/t22-,29-,32-,34+,35-,37+/m1/s1 |
| InChIKey | URNKXRSKEBJORP-PZPMAQFMSA-N |
| XLogP | 4.28 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |