C22H28O9 — CID 162829897
1-[1-hydroxy-6-methoxy-3-methyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]butan-1-one (PubChem CID 162829897) has the molecular formula C22H28O9 and a molecular weight of 436.46 g/mol. Its IUPAC name is 1-[1-hydroxy-6-methoxy-3-methyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]butan-1-one.
| Compound Name | 1-[1-hydroxy-6-methoxy-3-methyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]butan-1-one |
|---|---|
| PubChem CID | 162829897 |
| Molecular Formula | C22H28O9 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 1-[1-hydroxy-6-methoxy-3-methyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]butan-1-one |
| SMILES | CCCC(=O)c1c(C)cc2cc(OC)cc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2c1O |
| InChI | InChI=1S/C22H28O9/c1-4-5-13(24)16-10(2)6-11-7-12(29-3)8-14(17(11)19(16)26)30-22-21(28)20(27)18(25)15(9-23)31-22/h6-8,15,18,20-23,25-28H,4-5,9H2,1-3H3/t15-,18-,20+,21-,22+/m1/s1 |
| InChIKey | KECAUDIZBHZVFZ-DGHBBABESA-N |
| XLogP | 1.02 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |