C18H26O9 — CID 162954788
1-[2,4-dihydroxy-3,5-dimethyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]butan-1-one (PubChem CID 162954788) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is 1-[2,4-dihydroxy-3,5-dimethyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]butan-1-one.
| Compound Name | 1-[2,4-dihydroxy-3,5-dimethyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]butan-1-one |
|---|---|
| PubChem CID | 162954788 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-[2,4-dihydroxy-3,5-dimethyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]butan-1-one |
| SMILES | CCCC(=O)c1c(O)c(C)c(O)c(C)c1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H26O9/c1-4-5-9(20)11-13(22)7(2)12(21)8(3)17(11)27-18-16(25)15(24)14(23)10(6-19)26-18/h10,14-16,18-19,21-25H,4-6H2,1-3H3/t10-,14-,15+,16-,18+/m1/s1 |
| InChIKey | VGSZPOWOYWCLRF-XFFNJLRVSA-N |
| XLogP | -0.12 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |