C33H34O9 — CID 163099330
1-hydroxy-4-(2-phenylethyl)-2-[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxyanthracene-9,10-dione (PubChem CID 163099330) has the molecular formula C33H34O9 and a molecular weight of 574.63 g/mol. Its IUPAC name is 1-hydroxy-4-(2-phenylethyl)-2-[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxyanthracene-9,10-dione.
| Compound Name | 1-hydroxy-4-(2-phenylethyl)-2-[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 163099330 |
| Molecular Formula | C33H34O9 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 1-hydroxy-4-(2-phenylethyl)-2-[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(1-hydroxycyclohexyl)oxan-2-yl]oxyanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(O[C@H]3O[C@@H](C4(O)CCCCC4)[C@H](O)[C@@H](O)[C@@H]3O)cc(CCc3ccccc3)c21 |
| InChI | InChI=1S/C33H34O9/c34-25-20-11-5-6-12-21(20)26(35)24-23(25)19(14-13-18-9-3-1-4-10-18)17-22(27(24)36)41-32-30(39)28(37)29(38)31(42-32)33(40)15-7-2-8-16-33/h1,3-6,9-12,17,28-32,36-40H,2,7-8,13-16H2/t28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | MMOGCQMTKLDVCL-VJLURNNQSA-N |
| XLogP | 2.83 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|