C20H18O8 — CID 90870975
2-hydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-9,10-dione (PubChem CID 90870975) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is 2-hydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-9,10-dione.
| Compound Name | 2-hydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 90870975 |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-hydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-9,10-dione |
| SMILES | C[C@H]1OC(Oc2c(O)ccc3c2C(=O)c2ccccc2C3=O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H18O8/c1-8-14(22)17(25)18(26)20(27-8)28-19-12(21)7-6-11-13(19)16(24)10-5-3-2-4-9(10)15(11)23/h2-8,14,17-18,20-22,25-26H,1H3/t8-,14+,17+,18-,20?/m1/s1 |
| InChIKey | GRNGUDPCZOWBQY-SIVMVREJSA-N |
| XLogP | 0.37 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|