C83H100N2O11 — CID 162827281
CID 162827281 (PubChem CID 162827281) has the molecular formula C83H100N2O11 and a molecular weight of 1301.72 g/mol.
| Compound Name | CID 162827281 |
|---|---|
| PubChem CID | 162827281 |
| Molecular Formula | C83H100N2O11 |
| Molecular Weight | 1301.72 g/mol |
| Exact Mass | 1300.73 |
| IUPAC Name | — |
| SMILES | C[C@H]1[C@@H]2CCC[C@@H]2CC[C@@]12C=CC[C@]13OC45C(=C[C@@H]21)C[C@H]1CC2(CCCC2)C[C@]12C[C@@H]1C[C@]6(C)[C@]78O[C@@H]7C(=O)O[C@@]67c6c(coc6C[C@@H]([C@@H]6CC[C@@H]9[C@H](C=CN%10CNC[C@@H]9%10)C6)[C@H](O)CO)CC[C@@H]7C#C[C@H]6CC[C@@H](Cc7ccccc7)C[C@@H]6[C@]86[C@H](O)C(=O)[C@H]3[C@@]4(COC(=O)[C@H]52)[C@@H]16 |
| InChI | InChI=1S/C83H100N2O11/c1-45-57-13-8-12-48(57)22-28-76(45)26-9-27-79-64(76)34-55-33-56-38-75(24-6-7-25-75)42-77(56)37-53-36-74(2)81-54(20-17-52-41-92-63(65(52)81)35-59(62(87)40-86)50-18-21-58-51(32-50)23-29-85-44-84-39-61(58)85)19-16-49-15-14-47(30-46-10-4-3-5-11-46)31-60(49)80(83(74)71(94-83)73(91)95-81)67(53)78(68(79)66(88)70(80)89)43-93-72(90)69(77)82(55,78)96-79/h3-5,9-11,23,26,29,34,41,45,47-51,53-54,56-62,64,67-71,84,86-87,89H,6-8,12-15,17-18,20-22,24-25,27-28,30-33,35-40,42-44H2,1-2H3/t45-,47-,48+,49+,50+,51+,53-,54-,56-,57-,58+,59-,60-,61-,62+,64-,67+,68-,69-,70+,71+,74-,76-,77+,78+,79-,80-,81-,82?,83+/m0/s1 |
| InChIKey | OQIBNTHCCPNVEM-LGLLCOGKSA-N |
| XLogP | 11.30 |
| TPSA | 180.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1301.72 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|