C30H37N3O10 — CID 162827597
1-[[3-cyclohexyl-1-hydroxy-6-methoxy-9,10-dioxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]-2-methylguanidine (PubChem CID 162827597) has the molecular formula C30H37N3O10 and a molecular weight of 599.64 g/mol. Its IUPAC name is 1-[[3-cyclohexyl-1-hydroxy-6-methoxy-9,10-dioxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[[3-cyclohexyl-1-hydroxy-6-methoxy-9,10-dioxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 162827597 |
| Molecular Formula | C30H37N3O10 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 1-[[3-cyclohexyl-1-hydroxy-6-methoxy-9,10-dioxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCc1c(C2CCCCC2)cc2c(c1O)C(=O)c1c(OC3OC(CO)C(O)C(O)C3O)cc(OC)cc1C2=O |
| InChI | InChI=1S/C30H37N3O10/c1-32-30(31)33-11-18-15(13-6-4-3-5-7-13)10-17-22(24(18)36)26(38)21-16(23(17)35)8-14(41-2)9-19(21)42-29-28(40)27(39)25(37)20(12-34)43-29/h8-10,13,20,25,27-29,34,36-37,39-40H,3-7,11-12H2,1-2H3,(H3,31,32,33) |
| InChIKey | KJAMDZFGDUBQTE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 213.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|