C29H35N3O10 — CID 162876798
1-[[3-cyclopentyl-1-hydroxy-6-methoxy-9,10-dioxo-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]-2-methylguanidine (PubChem CID 162876798) has the molecular formula C29H35N3O10 and a molecular weight of 585.61 g/mol. Its IUPAC name is 1-[[3-cyclopentyl-1-hydroxy-6-methoxy-9,10-dioxo-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[[3-cyclopentyl-1-hydroxy-6-methoxy-9,10-dioxo-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 162876798 |
| Molecular Formula | C29H35N3O10 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | 1-[[3-cyclopentyl-1-hydroxy-6-methoxy-9,10-dioxo-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCc1c(C2CCCC2)cc2c(c1O)C(=O)c1c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(OC)cc1C2=O |
| InChI | InChI=1S/C29H35N3O10/c1-31-29(30)32-10-17-14(12-5-3-4-6-12)9-16-21(23(17)35)25(37)20-15(22(16)34)7-13(40-2)8-18(20)41-28-27(39)26(38)24(36)19(11-33)42-28/h7-9,12,19,24,26-28,33,35-36,38-39H,3-6,10-11H2,1-2H3,(H3,30,31,32)/t19-,24-,26+,27-,28-/m1/s1 |
| InChIKey | LJYVZCFZOKLMPL-YOAJFNSWSA-N |
| XLogP | 0.05 |
| TPSA | 213.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|