C38H48O14 — CID 162828291
[(1S,2R,4S,5S,6R,7R,9S,10S,11S,13R,15S)-2,5,7,9,11-pentaacetyloxy-1-hydroxy-4,12,12,15-tetramethyl-8-methylidene-14-oxo-10-tricyclo[11.2.1.02,6]hexadecanyl] benzoate (PubChem CID 162828291) has the molecular formula C38H48O14 and a molecular weight of 728.79 g/mol. Its IUPAC name is [(1S,2R,4S,5S,6R,7R,9S,10S,11S,13R,15S)-2,5,7,9,11-pentaacetyloxy-1-hydroxy-4,12,12,15-tetramethyl-8-methylidene-14-oxo-10-tricyclo[11.2.1.02,6]hexadecanyl] benzoate.
| Compound Name | [(1S,2R,4S,5S,6R,7R,9S,10S,11S,13R,15S)-2,5,7,9,11-pentaacetyloxy-1-hydroxy-4,12,12,15-tetramethyl-8-methylidene-14-oxo-10-tricyclo[11.2.1.02,6]hexadecanyl] benzoate |
|---|---|
| PubChem CID | 162828291 |
| Molecular Formula | C38H48O14 |
| Molecular Weight | 728.79 g/mol |
| Exact Mass | 728.30 |
| IUPAC Name | [(1S,2R,4S,5S,6R,7R,9S,10S,11S,13R,15S)-2,5,7,9,11-pentaacetyloxy-1-hydroxy-4,12,12,15-tetramethyl-8-methylidene-14-oxo-10-tricyclo[11.2.1.02,6]hexadecanyl] benzoate |
| SMILES | C=C1[C@H](OC(C)=O)[C@@H](OC(=O)c2ccccc2)[C@@H](OC(C)=O)C(C)(C)[C@H]2C[C@](O)([C@H](C)C2=O)[C@@]2(OC(C)=O)C[C@H](C)[C@H](OC(C)=O)[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C38H48O14/c1-18-16-38(52-25(8)43)28(30(18)47-21(4)39)31(48-22(5)40)19(2)32(49-23(6)41)33(51-35(45)26-14-12-11-13-15-26)34(50-24(7)42)36(9,10)27-17-37(38,46)20(3)29(27)44/h11-15,18,20,27-28,30-34,46H,2,16-17H2,1,3-10H3/t18-,20+,27-,28+,30-,31-,32-,33+,34+,37-,38+/m0/s1 |
| InChIKey | MHKOHNZLNLBGQF-AVOVNHAFSA-N |
| XLogP | 3.45 |
| TPSA | 195.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.79 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|