C35H42O12 — CID 163069564
[(1S,2S,3aR,5R,10R,11S,13R,13aR)-1,3a,11,13-tetraacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-10-yl] benzoate (PubChem CID 163069564) has the molecular formula C35H42O12 and a molecular weight of 654.71 g/mol. Its IUPAC name is [(1S,2S,3aR,5R,10R,11S,13R,13aR)-1,3a,11,13-tetraacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-10-yl] benzoate.
| Compound Name | [(1S,2S,3aR,5R,10R,11S,13R,13aR)-1,3a,11,13-tetraacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-10-yl] benzoate |
|---|---|
| PubChem CID | 163069564 |
| Molecular Formula | C35H42O12 |
| Molecular Weight | 654.71 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | [(1S,2S,3aR,5R,10R,11S,13R,13aR)-1,3a,11,13-tetraacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-10-yl] benzoate |
| SMILES | C=C1[C@H](OC(C)=O)[C@H]2[C@@H](OC(C)=O)[C@@H](C)C[C@]2(OC(C)=O)C(=O)[C@H](C)C=CC(C)(C)C(=O)[C@H](OC(=O)c2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C35H42O12/c1-18-15-16-34(8,9)32(41)30(46-33(42)25-13-11-10-12-14-25)29(45-23(6)38)20(3)28(44-22(5)37)26-27(43-21(4)36)19(2)17-35(26,31(18)40)47-24(7)39/h10-16,18-19,26-30H,3,17H2,1-2,4-9H3/t18-,19+,26-,27+,28+,29+,30-,35-/m1/s1 |
| InChIKey | XADCSFBCDAKNRG-YGBZREGDSA-N |
| XLogP | 3.89 |
| TPSA | 165.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|