C30H40O13 — CID 133052545
(1,3a,10,11-tetraacetyloxy-2-hydroxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,10,11,13,13a-hexahydro-1H-cyclopenta[12]annulen-13-yl) acetate (PubChem CID 133052545) has the molecular formula C30H40O13 and a molecular weight of 608.64 g/mol. Its IUPAC name is (1,3a,10,11-tetraacetyloxy-2-hydroxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,10,11,13,13a-hexahydro-1H-cyclopenta[12]annulen-13-yl) acetate.
| Compound Name | (1,3a,10,11-tetraacetyloxy-2-hydroxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,10,11,13,13a-hexahydro-1H-cyclopenta[12]annulen-13-yl) acetate |
|---|---|
| PubChem CID | 133052545 |
| Molecular Formula | C30H40O13 |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | (1,3a,10,11-tetraacetyloxy-2-hydroxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,10,11,13,13a-hexahydro-1H-cyclopenta[12]annulen-13-yl) acetate |
| SMILES | C=C1C(OC(C)=O)C(OC(C)=O)C(=O)C(C)(C)C=CC(C)C(=O)C2(OC(C)=O)CC(C)(O)C(OC(C)=O)C2C1OC(C)=O |
| InChI | InChI=1S/C30H40O13/c1-14-11-12-28(8,9)26(37)24(41-18(5)33)23(40-17(4)32)15(2)22(39-16(3)31)21-27(42-19(6)34)29(10,38)13-30(21,25(14)36)43-20(7)35/h11-12,14,21-24,27,38H,2,13H2,1,3-10H3 |
| InChIKey | RLIACMHWGOIUBV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 185.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|