C32H42O14 — CID 138404379
[(1R,5R,6E,13S,13aS)-1,2,3a,10,11-pentaacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,10,11,13,13a-hexahydro-1H-cyclopenta[12]annulen-13-yl] acetate (PubChem CID 138404379) has the molecular formula C32H42O14 and a molecular weight of 650.67 g/mol. Its IUPAC name is [(1R,5R,6E,13S,13aS)-1,2,3a,10,11-pentaacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,10,11,13,13a-hexahydro-1H-cyclopenta[12]annulen-13-yl] acetate.
| Compound Name | [(1R,5R,6E,13S,13aS)-1,2,3a,10,11-pentaacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,10,11,13,13a-hexahydro-1H-cyclopenta[12]annulen-13-yl] acetate |
|---|---|
| PubChem CID | 138404379 |
| Molecular Formula | C32H42O14 |
| Molecular Weight | 650.67 g/mol |
| Exact Mass | 650.26 |
| IUPAC Name | [(1R,5R,6E,13S,13aS)-1,2,3a,10,11-pentaacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,10,11,13,13a-hexahydro-1H-cyclopenta[12]annulen-13-yl] acetate |
| SMILES | C=C1C(OC(C)=O)C(OC(C)=O)C(=O)C(C)(C)/C=C/[C@@H](C)C(=O)C2(OC(C)=O)CC(C)(OC(C)=O)[C@H](OC(C)=O)C2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H42O14/c1-15-12-13-30(9,10)28(40)26(43-19(5)35)25(42-18(4)34)16(2)24(41-17(3)33)23-29(44-20(6)36)31(11,45-21(7)37)14-32(23,27(15)39)46-22(8)38/h12-13,15,23-26,29H,2,14H2,1,3-11H3/b13-12+/t15-,23?,24-,25?,26?,29-,31?,32?/m1/s1 |
| InChIKey | OFUTZNNUWRTXHO-OGKAYDSMSA-N |
| XLogP | 2.28 |
| TPSA | 191.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.67 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|