C23H34O5 — CID 162828598
[(2R,3S,3aS,4S,7R,7aS)-7,7a-dimethyl-4'-methylidene-3-(4-methyl-2-oxopentyl)-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] acetate (PubChem CID 162828598) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is [(2R,3S,3aS,4S,7R,7aS)-7,7a-dimethyl-4'-methylidene-3-(4-methyl-2-oxopentyl)-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] acetate.
| Compound Name | [(2R,3S,3aS,4S,7R,7aS)-7,7a-dimethyl-4'-methylidene-3-(4-methyl-2-oxopentyl)-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] acetate |
|---|---|
| PubChem CID | 162828598 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [(2R,3S,3aS,4S,7R,7aS)-7,7a-dimethyl-4'-methylidene-3-(4-methyl-2-oxopentyl)-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] acetate |
| SMILES | C=C1COC(=O)[C@@]12C[C@]1(C)[C@@H]([C@@H](OC(C)=O)CC[C@H]1C)[C@@H]2CC(=O)CC(C)C |
| InChI | InChI=1S/C23H34O5/c1-13(2)9-17(25)10-18-20-19(28-16(5)24)8-7-14(3)22(20,6)12-23(18)15(4)11-27-21(23)26/h13-14,18-20H,4,7-12H2,1-3,5-6H3/t14-,18+,19+,20-,22+,23+/m1/s1 |
| InChIKey | HUOCHTMOTHZYSC-FPEAWNEISA-N |
| XLogP | 4.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|