C22H30O7 — CID 163080476
[(2R,3R,3aR,4S,7S,7aR)-3-acetyloxy-7,7a-dimethyl-4'-methylidene-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] (3R)-3-hydroxy-2-methylidenebutanoate (PubChem CID 163080476) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is [(2R,3R,3aR,4S,7S,7aR)-3-acetyloxy-7,7a-dimethyl-4'-methylidene-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] (3R)-3-hydroxy-2-methylidenebutanoate.
| Compound Name | [(2R,3R,3aR,4S,7S,7aR)-3-acetyloxy-7,7a-dimethyl-4'-methylidene-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] (3R)-3-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 163080476 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [(2R,3R,3aR,4S,7S,7aR)-3-acetyloxy-7,7a-dimethyl-4'-methylidene-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] (3R)-3-hydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)O[C@H]1CC[C@H](C)[C@@]2(C)C[C@@]3(C(=C)COC3=O)[C@H](OC(C)=O)[C@@H]12)[C@@H](C)O |
| InChI | InChI=1S/C22H30O7/c1-11-7-8-16(29-19(25)13(3)14(4)23)17-18(28-15(5)24)22(10-21(11,17)6)12(2)9-27-20(22)26/h11,14,16-18,23H,2-3,7-10H2,1,4-6H3/t11-,14+,16-,17+,18+,21+,22+/m0/s1 |
| InChIKey | JYHIRKVWRPNDHA-YNRNHEAUSA-N |
| XLogP | 2.32 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|