C16H23Cl3O4 — CID 139092108
(1S,2R,3aS,5R,7S,7aR)-1,5-dihydroxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-2'-one;chloroform (PubChem CID 139092108) has the molecular formula C16H23Cl3O4 and a molecular weight of 385.72 g/mol. Its IUPAC name is (1S,2R,3aS,5R,7S,7aR)-1,5-dihydroxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-2'-one;chloroform.
| Compound Name | (1S,2R,3aS,5R,7S,7aR)-1,5-dihydroxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-2'-one;chloroform |
|---|---|
| PubChem CID | 139092108 |
| Molecular Formula | C16H23Cl3O4 |
| Molecular Weight | 385.72 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | (1S,2R,3aS,5R,7S,7aR)-1,5-dihydroxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-2'-one;chloroform |
| SMILES | C=C1COC(=O)[C@]12C[C@H]1C[C@H](O)C[C@H](C)[C@@]1(C)[C@@H]2O.ClC(Cl)Cl |
| InChI | InChI=1S/C15H22O4.CHCl3/c1-8-4-11(16)5-10-6-15(12(17)14(8,10)3)9(2)7-19-13(15)18;2-1(3)4/h8,10-12,16-17H,2,4-7H2,1,3H3;1H/t8-,10+,11+,12-,14+,15+;/m0./s1 |
| InChIKey | UXOXZCNCBDIOGF-KSKLYDPPSA-N |
| XLogP | 3.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|